C16H28N4O6 — CID 140699265
2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-tert-butyl-N-ethylcarbamate (PubChem CID 140699265) has the molecular formula C16H28N4O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-tert-butyl-N-ethylcarbamate.
| Compound Name | 2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-tert-butyl-N-ethylcarbamate |
|---|---|
| PubChem CID | 140699265 |
| Molecular Formula | C16H28N4O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-tert-butyl-N-ethylcarbamate |
| SMILES | CCN(C(=O)OCCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O)C(C)(C)C |
| InChI | InChI=1S/C16H28N4O6/c1-5-19(16(2,3)4)15(23)25-8-9-26-17-13(21)12-7-6-11-10-18(12)14(22)20(11)24/h11-12,24H,5-10H2,1-4H3,(H,17,21)/t11-,12+/m1/s1 |
| InChIKey | YPNIKPUPEXGHLQ-NEPJUHHUSA-N |
| XLogP | 0.95 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|