C15H26N4O6 — CID 86699593
tert-butyl N-[(2S)-1-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypropan-2-yl]carbamate (PubChem CID 86699593) has the molecular formula C15H26N4O6 and a molecular weight of 358.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86699593 |
| Molecular Formula | C15H26N4O6 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypropan-2-yl]carbamate |
| SMILES | C[C@@H](CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26N4O6/c1-9(16-13(21)25-15(2,3)4)8-24-17-12(20)11-6-5-10-7-18(11)14(22)19(10)23/h9-11,23H,5-8H2,1-4H3,(H,16,21)(H,17,20)/t9-,10+,11-/m0/s1 |
| InChIKey | MXSHUPNDZZTAMQ-AXFHLTTASA-N |
| XLogP | 0.61 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|