C20H33N5O8 — CID 123925426
ditert-butyl 4-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxypyrazolidine-1,2-dicarboxylate (PubChem CID 123925426) has the molecular formula C20H33N5O8 and a molecular weight of 471.51 g/mol. Its IUPAC name is ditert-butyl 4-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxypyrazolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 4-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxypyrazolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 123925426 |
| Molecular Formula | C20H33N5O8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | ditert-butyl 4-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxypyrazolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(ONC(=O)C2CCC3CN2C(=O)N3O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33N5O8/c1-19(2,3)31-17(28)23-10-13(11-24(23)18(29)32-20(4,5)6)33-21-15(26)14-8-7-12-9-22(14)16(27)25(12)30/h12-14,30H,7-11H2,1-6H3,(H,21,26) |
| InChIKey | PHYXMTDPTKCOMJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|