C14H23N5O6 — CID 140674143
tert-butyl N-[2-[2-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]hydrazinyl]-2-oxoethyl]carbamate (PubChem CID 140674143) has the molecular formula C14H23N5O6 and a molecular weight of 357.37 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]hydrazinyl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]hydrazinyl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 140674143 |
| Molecular Formula | C14H23N5O6 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | tert-butyl N-[2-[2-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]hydrazinyl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NNC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C14H23N5O6/c1-14(2,3)25-12(22)15-6-10(20)16-17-11(21)9-5-4-8-7-18(9)13(23)19(8)24/h8-9,24H,4-7H2,1-3H3,(H,15,22)(H,16,20)(H,17,21)/t8-,9+/m1/s1 |
| InChIKey | SNGCNHVCUCDNJS-BDAKNGLRSA-N |
| XLogP | -0.68 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|