C13H22N4O6 — CID 139484421
2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate (PubChem CID 139484421) has the molecular formula C13H22N4O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate.
| Compound Name | 2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate |
|---|---|
| PubChem CID | 139484421 |
| Molecular Formula | C13H22N4O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C13H22N4O6/c1-2-5-14-12(19)22-6-7-23-15-11(18)10-4-3-9-8-16(10)13(20)17(9)21/h9-10,21H,2-8H2,1H3,(H,14,19)(H,15,18)/t9-,10+/m1/s1 |
| InChIKey | ZJPIODCDBOJZFV-ZJUUUORDSA-N |
| XLogP | -0.17 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|