C20H28N4O6 — CID 130475894
2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate (PubChem CID 130475894) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate.
| Compound Name | 2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate |
|---|---|
| PubChem CID | 130475894 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C20H28N4O6/c1-2-10-21-19(26)28-11-12-29-22-18(25)17-9-8-16-13-23(17)20(27)24(16)30-14-15-6-4-3-5-7-15/h3-7,16-17H,2,8-14H2,1H3,(H,21,26)(H,22,25)/t16-,17+/m1/s1 |
| InChIKey | SDRRGYQVQBLLQN-SJORKVTESA-N |
| XLogP | 1.57 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|