C17H24N4O6S — CID 158214623
(2S,5R)-N-[2-(methanesulfonamido)ethoxy]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 158214623) has the molecular formula C17H24N4O6S and a molecular weight of 412.47 g/mol. Its IUPAC name is (2S,5R)-N-[2-(methanesulfonamido)ethoxy]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,5R)-N-[2-(methanesulfonamido)ethoxy]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 158214623 |
| Molecular Formula | C17H24N4O6S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (2S,5R)-N-[2-(methanesulfonamido)ethoxy]-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | CS(=O)(=O)NCCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C17H24N4O6S/c1-28(24,25)18-9-10-26-19-16(22)15-8-7-14-11-20(15)17(23)21(14)27-12-13-5-3-2-4-6-13/h2-6,14-15,18H,7-12H2,1H3,(H,19,22)/t14-,15+/m1/s1 |
| InChIKey | NZZAPXDPDNYMJS-CABCVRRESA-N |
| XLogP | -0.02 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|