C22H31N5O7 — CID 123973399
tert-butyl N-[2-[(7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyethylcarbamoyl]carbamate (PubChem CID 123973399) has the molecular formula C22H31N5O7 and a molecular weight of 477.52 g/mol. Its IUPAC name is tert-butyl N-[2-[(7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyethylcarbamoyl]carbamate.
| Compound Name | tert-butyl N-[2-[(7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyethylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 123973399 |
| Molecular Formula | C22H31N5O7 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | tert-butyl N-[2-[(7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyethylcarbamoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)NCCONC(=O)C1CCC2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C22H31N5O7/c1-22(2,3)34-20(30)24-19(29)23-11-12-32-25-18(28)17-10-9-16-13-26(17)21(31)27(16)33-14-15-7-5-4-6-8-15/h4-8,16-17H,9-14H2,1-3H3,(H,25,28)(H2,23,24,29,30) |
| InChIKey | GVVAIUIINZIYDG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|