C24H36N4O6 — CID 118073867
4,4-dimethylpentan-2-yl-[2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid (PubChem CID 118073867) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is 4,4-dimethylpentan-2-yl-[2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid.
| Compound Name | 4,4-dimethylpentan-2-yl-[2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid |
|---|---|
| PubChem CID | 118073867 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 4,4-dimethylpentan-2-yl-[2-[[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid |
| SMILES | CC(CC(C)(C)C)N(CCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H36N4O6/c1-17(14-24(2,3)4)26(23(31)32)12-13-33-25-21(29)20-11-10-19-15-27(20)22(30)28(19)34-16-18-8-6-5-7-9-18/h5-9,17,19-20H,10-16H2,1-4H3,(H,25,29)(H,31,32)/t17?,19-,20+/m1/s1 |
| InChIKey | ISSNQYHFFQWXSS-GQXIWKRZSA-N |
| XLogP | 3.24 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|