C22H37N5O6 — CID 90397787
tert-butyl (3R)-3-[[[(2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 90397787) has the molecular formula C22H37N5O6 and a molecular weight of 467.57 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[[(2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[[(2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90397787 |
| Molecular Formula | C22H37N5O6 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | tert-butyl (3R)-3-[[[(2S,5R)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCCCON1C(=O)N2C[C@H]1CC[C@H]2C(=O)NNC(=O)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H37N5O6/c1-5-6-12-32-27-16-9-10-17(26(14-16)20(27)30)19(29)24-23-18(28)15-8-7-11-25(13-15)21(31)33-22(2,3)4/h15-17H,5-14H2,1-4H3,(H,23,28)(H,24,29)/t15-,16-,17+/m1/s1 |
| InChIKey | RDIGLVXXWGWHOA-ZACQAIPSSA-N |
| XLogP | 1.78 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|