C21H36N4O6 — CID 118086747
tert-butyl (2R)-2-[[[(2S)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 118086747) has the molecular formula C21H36N4O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[[(2S)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[[(2S)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118086747 |
| Molecular Formula | C21H36N4O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | tert-butyl (2R)-2-[[[(2S)-6-butoxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCON1C(=O)N2CC1CC[C@H]2C(=O)NOC[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36N4O6/c1-5-6-12-30-25-15-9-10-17(24(13-15)19(25)27)18(26)22-29-14-16-8-7-11-23(16)20(28)31-21(2,3)4/h15-17H,5-14H2,1-4H3,(H,22,26)/t15?,16-,17+/m1/s1 |
| InChIKey | WPOPMEKNRHNSQR-FGJGXXMFSA-N |
| XLogP | 2.43 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|