C17H30N4O6 — CID 126722836
tert-butyl (2S)-2-[[[(4S)-3-ethyl-1-hydroxy-2-oxo-1,3-diazinane-4-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 126722836) has the molecular formula C17H30N4O6 and a molecular weight of 386.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[(4S)-3-ethyl-1-hydroxy-2-oxo-1,3-diazinane-4-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[[(4S)-3-ethyl-1-hydroxy-2-oxo-1,3-diazinane-4-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126722836 |
| Molecular Formula | C17H30N4O6 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl (2S)-2-[[[(4S)-3-ethyl-1-hydroxy-2-oxo-1,3-diazinane-4-carbonyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCN1C(=O)N(O)CC[C@H]1C(=O)NOC[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N4O6/c1-5-19-13(8-10-21(25)15(19)23)14(22)18-26-11-12-7-6-9-20(12)16(24)27-17(2,3)4/h12-13,25H,5-11H2,1-4H3,(H,18,22)/t12-,13-/m0/s1 |
| InChIKey | PERYOOMEERCLDB-STQMWFEESA-N |
| XLogP | 1.34 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|