C11H21NO5S — CID 13008759
tert-butyl (2R)-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 13008759) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is tert-butyl (2R)-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 13008759 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | tert-butyl (2R)-2-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C11H21NO5S/c1-11(2,3)17-10(13)12-7-5-6-9(12)8-16-18(4,14)15/h9H,5-8H2,1-4H3/t9-/m1/s1 |
| InChIKey | HNCVRGCNKZVUSU-SECBINFHSA-N |
| XLogP | 1.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|