C13H25NO8S2 — CID 164740946
tert-butyl (2S,5R)-2,5-bis(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 164740946) has the molecular formula C13H25NO8S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2,5-bis(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2,5-bis(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164740946 |
| Molecular Formula | C13H25NO8S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | tert-butyl (2S,5R)-2,5-bis(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COS(C)(=O)=O)CC[C@H]1COS(C)(=O)=O |
| InChI | InChI=1S/C13H25NO8S2/c1-13(2,3)22-12(15)14-10(8-20-23(4,16)17)6-7-11(14)9-21-24(5,18)19/h10-11H,6-9H2,1-5H3/t10-,11+ |
| InChIKey | RNZKAYDACGUVMH-PHIMTYICSA-N |
| XLogP | 0.71 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|