C18H27NO6S — CID 86691871
tert-butyl 2-(hydroxymethyl)-5-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate (PubChem CID 86691871) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-5-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-5-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86691871 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-5-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCC(CO)N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO6S/c1-13-5-9-16(10-6-13)26(22,23)24-12-15-8-7-14(11-20)19(15)17(21)25-18(2,3)4/h5-6,9-10,14-15,20H,7-8,11-12H2,1-4H3 |
| InChIKey | HBQWBZXNNIJIDV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|