C22H35NO5S — CID 155600125
tert-butyl 2-tert-butyl-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate (PubChem CID 155600125) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155600125 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl 2-tert-butyl-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCN(C(=O)OC(C)(C)C)C(C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C22H35NO5S/c1-16-8-10-18(11-9-16)29(25,26)27-15-17-12-13-23(19(14-17)21(2,3)4)20(24)28-22(5,6)7/h8-11,17,19H,12-15H2,1-7H3 |
| InChIKey | AQEGQUNNYYSPGA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|