C17H25NO6S — CID 171504587
tert-butyl (2R,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate (PubChem CID 171504587) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171504587 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | tert-butyl (2R,3S)-3-hydroxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2[C@@H](O)CCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO6S/c1-12-5-7-13(8-6-12)25(21,22)23-11-14-15(19)9-10-18(14)16(20)24-17(2,3)4/h5-8,14-15,19H,9-11H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | VSYQAXPJHGZPIA-CABCVRRESA-N |
| XLogP | 2.07 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|