C19H29NO6S — CID 89063589
tert-butyl (4S)-3-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate (PubChem CID 89063589) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is tert-butyl (4S)-3-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89063589 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl (4S)-3-methoxy-4-[(4-methylphenyl)sulfonyloxymethyl]piperidine-1-carboxylate |
| SMILES | COC1CN(C(=O)OC(C)(C)C)CC[C@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H29NO6S/c1-14-6-8-16(9-7-14)27(22,23)25-13-15-10-11-20(12-17(15)24-5)18(21)26-19(2,3)4/h6-9,15,17H,10-13H2,1-5H3/t15-,17?/m0/s1 |
| InChIKey | YIEXHCODYBKAAZ-MYJWUSKBSA-N |
| XLogP | 2.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|