C19H29NO6S — CID 123934090
tert-butyl 3-[1-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate (PubChem CID 123934090) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is tert-butyl 3-[1-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123934090 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | tert-butyl 3-[1-hydroxy-3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(O)C2CCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29NO6S/c1-14-5-7-16(8-6-14)27(23,24)25-12-10-17(21)15-9-11-20(13-15)18(22)26-19(2,3)4/h5-8,15,17,21H,9-13H2,1-4H3 |
| InChIKey | IOAQXLLOPVVYHY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|