C25H33NO8S2 — CID 169122956
tert-butyl (3S,4S)-3,4-bis[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate (PubChem CID 169122956) has the molecular formula C25H33NO8S2 and a molecular weight of 539.67 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3,4-bis[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3,4-bis[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169122956 |
| Molecular Formula | C25H33NO8S2 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | tert-butyl (3S,4S)-3,4-bis[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CN(C(=O)OC(C)(C)C)C[C@H]2COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H33NO8S2/c1-18-6-10-22(11-7-18)35(28,29)32-16-20-14-26(24(27)34-25(3,4)5)15-21(20)17-33-36(30,31)23-12-8-19(2)9-13-23/h6-13,20-21H,14-17H2,1-5H3/t20-,21-/m0/s1 |
| InChIKey | NTZPDTKYBRKIMM-SFTDATJTSA-N |
| XLogP | 3.90 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|