C23H39NO6SSi — CID 86600446
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate (PubChem CID 86600446) has the molecular formula C23H39NO6SSi and a molecular weight of 485.72 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86600446 |
| Molecular Formula | C23H39NO6SSi |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H39NO6SSi/c1-17-10-12-20(13-11-17)31(26,27)28-16-18-14-19(30-32(8,9)23(5,6)7)15-24(18)21(25)29-22(2,3)4/h10-13,18-19H,14-16H2,1-9H3/t18-,19+/m0/s1 |
| InChIKey | DHNNVTRVTJWHTK-RBUKOAKNSA-N |
| XLogP | 5.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|