C24H36N2O5Si — CID 68850565
tert-butyl (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 68850565) has the molecular formula C24H36N2O5Si and a molecular weight of 460.65 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68850565 |
| Molecular Formula | C24H36N2O5Si |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | tert-butyl (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1,3-dioxoisoindol-2-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H36N2O5Si/c1-23(2,3)30-22(29)25-15-17(31-32(7,8)24(4,5)6)13-16(25)14-26-20(27)18-11-9-10-12-19(18)21(26)28/h9-12,16-17H,13-15H2,1-8H3/t16-,17+/m1/s1 |
| InChIKey | ZQVKPECIJBPJKQ-SJORKVTESA-N |
| XLogP | 4.68 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|