C17H18N2O5 — CID 142948980
tert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidine-1-carboxylate (PubChem CID 142948980) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is tert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 142948980 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | tert-butyl 2-[(1,3-dioxoisoindol-2-yl)methyl]-4-oxoazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CC1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H18N2O5/c1-17(2,3)24-16(23)19-10(8-13(19)20)9-18-14(21)11-6-4-5-7-12(11)15(18)22/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | WBOUTTCCESHWLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|