C21H26N2O4 — CID 90328144
tert-butyl (3R,4S,5R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-5-methyl-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 90328144) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl (3R,4S,5R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-5-methyl-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (3R,4S,5R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-5-methyl-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 90328144 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl (3R,4S,5R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-5-methyl-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C[C@@H]1CC2C[C@@H]1[C@H](CN1C(=O)c3ccccc3C1=O)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26N2O4/c1-12-9-13-10-16(12)17(23(13)20(26)27-21(2,3)4)11-22-18(24)14-7-5-6-8-15(14)19(22)25/h5-8,12-13,16-17H,9-11H2,1-4H3/t12-,13?,16+,17+/m1/s1 |
| InChIKey | XNRTXWDPVNJJAD-LLDGALLGSA-N |
| XLogP | 3.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|