C20H22F2N2O4 — CID 90328130
tert-butyl (3S,4S)-3-[(1,3-dioxoisoindol-2-yl)methyl]-6,6-difluoro-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 90328130) has the molecular formula C20H22F2N2O4 and a molecular weight of 392.40 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-[(1,3-dioxoisoindol-2-yl)methyl]-6,6-difluoro-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-[(1,3-dioxoisoindol-2-yl)methyl]-6,6-difluoro-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 90328130 |
| Molecular Formula | C20H22F2N2O4 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | tert-butyl (3S,4S)-3-[(1,3-dioxoisoindol-2-yl)methyl]-6,6-difluoro-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C[C@@H](CC2(F)F)[C@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H22F2N2O4/c1-19(2,3)28-18(27)24-14(11-8-15(24)20(21,22)9-11)10-23-16(25)12-6-4-5-7-13(12)17(23)26/h4-7,11,14-15H,8-10H2,1-3H3/t11-,14+,15?/m0/s1 |
| InChIKey | VSDMYXPWCOZAAE-NFCBODTESA-N |
| XLogP | 3.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|