C20H23FN2O4 — CID 91098321
tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]piperidine-1-carboxylate (PubChem CID 91098321) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91098321 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | tert-butyl 3-[2-(1,3-dioxoisoindol-2-yl)-1-fluoroethylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=C(F)CN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C20H23FN2O4/c1-20(2,3)27-19(26)22-10-6-7-13(11-22)16(21)12-23-17(24)14-8-4-5-9-15(14)18(23)25/h4-5,8-9H,6-7,10-12H2,1-3H3 |
| InChIKey | YYTNNDBZLXRBFO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|