C22H28N4O6 — CID 108543113
tert-butyl N-[2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate (PubChem CID 108543113) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108543113 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl N-[2-[4-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C22H28N4O6/c1-22(2,3)32-21(31)23-13-17(27)24-9-6-10-25(12-11-24)18(28)14-26-19(29)15-7-4-5-8-16(15)20(26)30/h4-5,7-8H,6,9-14H2,1-3H3,(H,23,31) |
| InChIKey | HWWSGXQNUPRYKD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|