C22H28N4O5 — CID 142948949
tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-4-oxo-4-pyrrolidin-1-ylbutan-2-yl]carbamate;formonitrile (PubChem CID 142948949) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-4-oxo-4-pyrrolidin-1-ylbutan-2-yl]carbamate;formonitrile.
| Compound Name | tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-4-oxo-4-pyrrolidin-1-ylbutan-2-yl]carbamate;formonitrile |
|---|---|
| PubChem CID | 142948949 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl N-[1-(1,3-dioxoisoindol-2-yl)-4-oxo-4-pyrrolidin-1-ylbutan-2-yl]carbamate;formonitrile |
| SMILES | C#N.CC(C)(C)OC(=O)NC(CC(=O)N1CCCC1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H27N3O5.CHN/c1-21(2,3)29-20(28)22-14(12-17(25)23-10-6-7-11-23)13-24-18(26)15-8-4-5-9-16(15)19(24)27;1-2/h4-5,8-9,14H,6-7,10-13H2,1-3H3,(H,22,28);1H |
| InChIKey | AXTOHGMFJNUOSL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|