C26H34N2O3 — CID 126641830
tert-butyl N-[5-oxo-1-(4-phenylphenyl)-5-pyrrolidin-1-ylpentan-2-yl]carbamate (PubChem CID 126641830) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl N-[5-oxo-1-(4-phenylphenyl)-5-pyrrolidin-1-ylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-oxo-1-(4-phenylphenyl)-5-pyrrolidin-1-ylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 126641830 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | tert-butyl N-[5-oxo-1-(4-phenylphenyl)-5-pyrrolidin-1-ylpentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)N1CCCC1)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-26(2,3)31-25(30)27-23(15-16-24(29)28-17-7-8-18-28)19-20-11-13-22(14-12-20)21-9-5-4-6-10-21/h4-6,9-14,23H,7-8,15-19H2,1-3H3,(H,27,30) |
| InChIKey | CVCBWLNJJSESNL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |