C18H26N2O2S — CID 14082895
tert-butyl N-[(2S)-3-phenyl-1-pyrrolidin-1-yl-1-sulfanylidenepropan-2-yl]carbamate (PubChem CID 14082895) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-phenyl-1-pyrrolidin-1-yl-1-sulfanylidenepropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-phenyl-1-pyrrolidin-1-yl-1-sulfanylidenepropan-2-yl]carbamate |
|---|---|
| PubChem CID | 14082895 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | tert-butyl N-[(2S)-3-phenyl-1-pyrrolidin-1-yl-1-sulfanylidenepropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=S)N1CCCC1 |
| InChI | InChI=1S/C18H26N2O2S/c1-18(2,3)22-17(21)19-15(13-14-9-5-4-6-10-14)16(23)20-11-7-8-12-20/h4-6,9-10,15H,7-8,11-13H2,1-3H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | HTBOVAIZEKLASI-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|