C23H28KNO4 — CID 173034274
potassium;hydride;(4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoic acid (PubChem CID 173034274) has the molecular formula C23H28KNO4 and a molecular weight of 421.58 g/mol. Its IUPAC name is potassium;hydride;(4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoic acid.
| Compound Name | potassium;hydride;(4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 173034274 |
| Molecular Formula | C23H28KNO4 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | potassium;hydride;(4R)-2-methylidene-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanoic acid |
| SMILES | C=C(C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)OC(C)(C)C)C(=O)O.[H-].[K+] |
| InChI | InChI=1S/C23H27NO4.K.H/c1-16(21(25)26)14-20(24-22(27)28-23(2,3)4)15-17-10-12-19(13-11-17)18-8-6-5-7-9-18;;/h5-13,20H,1,14-15H2,2-4H3,(H,24,27)(H,25,26);;/q;+1;-1/t20-;;/m0../s1 |
| InChIKey | AQVDFPDFIUMRML-FJSYBICCSA-N |
| XLogP | 1.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|