C21H28N2O6 — CID 68515882
benzyl (3S)-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 68515882) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is benzyl (3S)-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl (3S)-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 68515882 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | benzyl (3S)-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC1CC(=O)N(C[C@H](CC(=O)OCc2ccccc2)NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C21H28N2O6/c1-14-10-17(24)23(19(14)26)12-16(22-20(27)29-21(2,3)4)11-18(25)28-13-15-8-6-5-7-9-15/h5-9,14,16H,10-13H2,1-4H3,(H,22,27)/t14?,16-/m0/s1 |
| InChIKey | LEBMISYYRJURGA-WMCAAGNKSA-N |
| XLogP | 2.41 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|