C20H31N3O5 — CID 50986379
benzyl N-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-morpholin-4-ylpropyl]carbamate (PubChem CID 50986379) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is benzyl N-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-morpholin-4-ylpropyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-morpholin-4-ylpropyl]carbamate |
|---|---|
| PubChem CID | 50986379 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | benzyl N-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-morpholin-4-ylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCc1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C20H31N3O5/c1-20(2,3)28-19(25)22-17(14-23-9-11-26-12-10-23)13-21-18(24)27-15-16-7-5-4-6-8-16/h4-8,17H,9-15H2,1-3H3,(H,21,24)(H,22,25)/t17-/m0/s1 |
| InChIKey | JRBKFHWCXVELCA-KRWDZBQOSA-N |
| XLogP | 2.14 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |