C25H40N4O7 — CID 86624495
benzyl N-[2-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-2-oxoethyl]carbamate (PubChem CID 86624495) has the molecular formula C25H40N4O7 and a molecular weight of 508.62 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 86624495 |
| Molecular Formula | C25H40N4O7 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | benzyl N-[2-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CNC(=O)CNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40N4O7/c1-24(2,3)35-22(32)26-14-10-13-19(29-23(33)36-25(4,5)6)15-27-20(30)16-28-21(31)34-17-18-11-8-7-9-12-18/h7-9,11-12,19H,10,13-17H2,1-6H3,(H,26,32)(H,27,30)(H,28,31)(H,29,33)/t19-/m0/s1 |
| InChIKey | IBPDNLBNFPHCRS-IBGZPJMESA-N |
| XLogP | 3.23 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|