C18H29N3O4 — CID 130376705
benzyl N-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate (PubChem CID 130376705) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is benzyl N-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 130376705 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | benzyl N-[(2S)-1-amino-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CN)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H29N3O4/c1-18(2,3)25-16(22)20-11-7-10-15(12-19)21-17(23)24-13-14-8-5-4-6-9-14/h4-6,8-9,15H,7,10-13,19H2,1-3H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | KRSHOSGFYCGBQP-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|