C17H25IN2O4 — CID 59008227
benzyl N-[(2R)-1-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate (PubChem CID 59008227) has the molecular formula C17H25IN2O4 and a molecular weight of 448.30 g/mol. Its IUPAC name is benzyl N-[(2R)-1-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59008227 |
| Molecular Formula | C17H25IN2O4 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | benzyl N-[(2R)-1-iodo-4-[(2-methylpropan-2-yl)oxycarbonylamino]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@H](CI)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25IN2O4/c1-17(2,3)24-15(21)19-10-9-14(11-18)20-16(22)23-12-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | JFEHSHOWKBORBX-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|