C17H25IN2O4 — CID 69437729
tert-butyl-[(3R)-4-iodo-3-(phenylmethoxycarbonylamino)butyl]carbamic acid (PubChem CID 69437729) has the molecular formula C17H25IN2O4 and a molecular weight of 448.30 g/mol. Its IUPAC name is tert-butyl-[(3R)-4-iodo-3-(phenylmethoxycarbonylamino)butyl]carbamic acid.
| Compound Name | tert-butyl-[(3R)-4-iodo-3-(phenylmethoxycarbonylamino)butyl]carbamic acid |
|---|---|
| PubChem CID | 69437729 |
| Molecular Formula | C17H25IN2O4 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | tert-butyl-[(3R)-4-iodo-3-(phenylmethoxycarbonylamino)butyl]carbamic acid |
| SMILES | CC(C)(C)N(CC[C@H](CI)NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25IN2O4/c1-17(2,3)20(16(22)23)10-9-14(11-18)19-15(21)24-12-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,19,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | FGIISNXUVYWWKZ-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|