C34H44N4O6 — CID 67268995
4-[3-aminopropyl(phenylmethoxycarbonyl)amino]butyl-[4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamic acid (PubChem CID 67268995) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is 4-[3-aminopropyl(phenylmethoxycarbonyl)amino]butyl-[4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamic acid.
| Compound Name | 4-[3-aminopropyl(phenylmethoxycarbonyl)amino]butyl-[4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamic acid |
|---|---|
| PubChem CID | 67268995 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | 4-[3-aminopropyl(phenylmethoxycarbonyl)amino]butyl-[4-phenyl-3-(phenylmethoxycarbonylamino)butyl]carbamic acid |
| SMILES | NCCCN(CCCCN(CCC(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H44N4O6/c35-20-12-23-38(34(42)44-27-30-17-8-3-9-18-30)22-11-10-21-37(33(40)41)24-19-31(25-28-13-4-1-5-14-28)36-32(39)43-26-29-15-6-2-7-16-29/h1-9,13-18,31H,10-12,19-27,35H2,(H,36,39)(H,40,41) |
| InChIKey | URQULXFRHXHSTD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|