C14H21N3O3 — CID 7020264
benzyl N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate (PubChem CID 7020264) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is benzyl N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 7020264 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | benzyl N-[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamate |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H21N3O3/c15-9-5-4-8-12(13(16)18)17-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H2,16,18)(H,17,19)/t12-/m0/s1 |
| InChIKey | YVKFETNYOZKEGT-LBPRGKRZSA-N |
| XLogP | 0.90 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|