C11H15N3O3 — CID 130155607
benzyl N-(1,3-diamino-1-oxopropan-2-yl)carbamate (PubChem CID 130155607) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is benzyl N-(1,3-diamino-1-oxopropan-2-yl)carbamate.
| Compound Name | benzyl N-(1,3-diamino-1-oxopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 130155607 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | benzyl N-(1,3-diamino-1-oxopropan-2-yl)carbamate |
| SMILES | NCC(NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C11H15N3O3/c12-6-9(10(13)15)14-11(16)17-7-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H2,13,15)(H,14,16) |
| InChIKey | GAHOZZIFSOKFPK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |