C13H16N2O5 — CID 11076827
methyl 4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 11076827) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl 4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 11076827 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 4-amino-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)CC(NC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C13H16N2O5/c1-19-11(16)7-10(12(14)17)15-13(18)20-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H2,14,17)(H,15,18) |
| InChIKey | MIYFFPQOLUXZCQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |