C19H31N3O4 — CID 11326021
benzyl N-(3-aminopropyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 11326021) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is benzyl N-(3-aminopropyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | benzyl N-(3-aminopropyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 11326021 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | benzyl N-(3-aminopropyl)-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H31N3O4/c1-19(2,3)26-17(23)21-12-8-14-22(13-7-11-20)18(24)25-15-16-9-5-4-6-10-16/h4-6,9-10H,7-8,11-15,20H2,1-3H3,(H,21,23) |
| InChIKey | XUKPPFDFYIYSEK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|