C37H56N4O10 — CID 159668272
ethyl 2-[3-aminopropyl(phenylmethoxycarbonyl)amino]propanoate;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-phenylmethoxycarbonylamino]propanoate (PubChem CID 159668272) has the molecular formula C37H56N4O10 and a molecular weight of 716.87 g/mol. Its IUPAC name is ethyl 2-[3-aminopropyl(phenylmethoxycarbonyl)amino]propanoate;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-phenylmethoxycarbonylamino]propanoate.
| Compound Name | ethyl 2-[3-aminopropyl(phenylmethoxycarbonyl)amino]propanoate;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-phenylmethoxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 159668272 |
| Molecular Formula | C37H56N4O10 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.40 |
| IUPAC Name | ethyl 2-[3-aminopropyl(phenylmethoxycarbonyl)amino]propanoate;ethyl 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl-phenylmethoxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(C)N(CCCN)C(=O)OCc1ccccc1.CCOC(=O)C(C)N(CCCNC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O6.C16H24N2O4/c1-6-27-18(24)16(2)23(14-10-13-22-19(25)29-21(3,4)5)20(26)28-15-17-11-8-7-9-12-17;1-3-21-15(19)13(2)18(11-7-10-17)16(20)22-12-14-8-5-4-6-9-14/h7-9,11-12,16H,6,10,13-15H2,1-5H3,(H,22,25);4-6,8-9,13H,3,7,10-12,17H2,1-2H3 |
| InChIKey | MTRQSEZLLBUMEB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 176.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|