C26H39N3O9 — CID 54301337
(4R)-4-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-phenylmethoxycarbonylamino]-5-ethoxy-5-oxopentanoic acid (PubChem CID 54301337) has the molecular formula C26H39N3O9 and a molecular weight of 537.61 g/mol. Its IUPAC name is (4R)-4-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-phenylmethoxycarbonylamino]-5-ethoxy-5-oxopentanoic acid.
| Compound Name | (4R)-4-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-phenylmethoxycarbonylamino]-5-ethoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54301337 |
| Molecular Formula | C26H39N3O9 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (4R)-4-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]-phenylmethoxycarbonylamino]-5-ethoxy-5-oxopentanoic acid |
| SMILES | CCOC(=O)[C@@H](CCC(=O)O)N(C(=O)OCc1ccccc1)C(=O)[C@@H](N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H39N3O9/c1-5-36-23(33)20(14-15-21(30)31)29(25(35)37-17-18-11-7-6-8-12-18)22(32)19(27)13-9-10-16-28-24(34)38-26(2,3)4/h6-8,11-12,19-20H,5,9-10,13-17,27H2,1-4H3,(H,28,34)(H,30,31)/t19-,20+/m0/s1 |
| InChIKey | SEKHVNUQGIHTHH-VQTJNVASSA-N |
| XLogP | 2.97 |
| TPSA | 174.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|