C21H33N3O6 — CID 18607807
(3S,4S)-3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(phenylmethoxycarbonylamino)octanoic acid (PubChem CID 18607807) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3S,4S)-3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(phenylmethoxycarbonylamino)octanoic acid.
| Compound Name | (3S,4S)-3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(phenylmethoxycarbonylamino)octanoic acid |
|---|---|
| PubChem CID | 18607807 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (3S,4S)-3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]-8-(phenylmethoxycarbonylamino)octanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C21H33N3O6/c1-21(2,3)30-20(28)24-17(16(22)13-18(25)26)11-7-8-12-23-19(27)29-14-15-9-5-4-6-10-15/h4-6,9-10,16-17H,7-8,11-14,22H2,1-3H3,(H,23,27)(H,24,28)(H,25,26)/t16-,17-/m0/s1 |
| InChIKey | KOAZDQHKXJBQKL-IRXDYDNUSA-N |
| XLogP | 2.78 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|