C20H32N2O6 — CID 10548778
benzyl N-[(5S,6S)-6,7-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptyl]carbamate (PubChem CID 10548778) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is benzyl N-[(5S,6S)-6,7-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptyl]carbamate.
| Compound Name | benzyl N-[(5S,6S)-6,7-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptyl]carbamate |
|---|---|
| PubChem CID | 10548778 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | benzyl N-[(5S,6S)-6,7-dihydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C20H32N2O6/c1-20(2,3)28-19(26)22-16(17(24)13-23)11-7-8-12-21-18(25)27-14-15-9-5-4-6-10-15/h4-6,9-10,16-17,23-24H,7-8,11-14H2,1-3H3,(H,21,25)(H,22,26)/t16-,17+/m0/s1 |
| InChIKey | BNLKBEXSDLFJRM-DLBZAZTESA-N |
| XLogP | 2.33 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|