C28H38N2O8 — CID 11977014
methyl (2R,3R,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxy-7-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 11977014) has the molecular formula C28H38N2O8 and a molecular weight of 530.62 g/mol. Its IUPAC name is methyl (2R,3R,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxy-7-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | methyl (2R,3R,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxy-7-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 11977014 |
| Molecular Formula | C28H38N2O8 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | methyl (2R,3R,4S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxy-7-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | COC(=O)[C@H](O)[C@H](OCc1ccccc1)[C@H](CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38N2O8/c1-28(2,3)38-27(34)30-22(16-11-17-29-26(33)37-19-21-14-9-6-10-15-21)24(23(31)25(32)35-4)36-18-20-12-7-5-8-13-20/h5-10,12-15,22-24,31H,11,16-19H2,1-4H3,(H,29,33)(H,30,34)/t22-,23+,24+/m0/s1 |
| InChIKey | LZYLSGKBQHJVKA-RBZQAINGSA-N |
| XLogP | 3.71 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|