C20H30N2O7 — CID 164680842
methyl (2S,3S)-3-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 164680842) has the molecular formula C20H30N2O7 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S,3S)-3-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 164680842 |
| Molecular Formula | C20H30N2O7 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30N2O7/c1-20(2,3)29-18(25)21-12-8-11-15(23)16(17(24)27-4)22-19(26)28-13-14-9-6-5-7-10-14/h5-7,9-10,15-16,23H,8,11-13H2,1-4H3,(H,21,25)(H,22,26)/t15-,16-/m0/s1 |
| InChIKey | AQYUTXHNFGDRKF-HOTGVXAUSA-N |
| XLogP | 2.12 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|