C19H26N2O5 — CID 134874199
benzyl N-[(3S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohex-1-en-3-yl]carbamate (PubChem CID 134874199) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is benzyl N-[(3S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohex-1-en-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 134874199 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | benzyl N-[(3S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohex-1-en-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C=C=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H26N2O5/c1-19(2,3)26-17(23)20-12-7-10-16(11-13-22)21-18(24)25-14-15-8-5-4-6-9-15/h4-6,8-9,11,16H,7,10,12,14H2,1-3H3,(H,20,23)(H,21,24)/t16-/m0/s1 |
| InChIKey | ZOFWRGWFEOTMAV-INIZCTEOSA-N |
| XLogP | 2.97 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|