C28H45N3O8 — CID 11628191
methyl (2S)-2-[[(4R,5S)-4-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)octanoyl]amino]-4-methylpentanoate (PubChem CID 11628191) has the molecular formula C28H45N3O8 and a molecular weight of 551.68 g/mol. Its IUPAC name is methyl (2S)-2-[[(4R,5S)-4-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)octanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(4R,5S)-4-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)octanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11628191 |
| Molecular Formula | C28H45N3O8 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | methyl (2S)-2-[[(4R,5S)-4-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)octanoyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)CC[C@@H](O)[C@H](CCCNC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H45N3O8/c1-19(2)17-22(25(34)37-6)30-24(33)15-14-23(32)21(13-10-16-29-26(35)39-28(3,4)5)31-27(36)38-18-20-11-8-7-9-12-20/h7-9,11-12,19,21-23,32H,10,13-18H2,1-6H3,(H,29,35)(H,30,33)(H,31,36)/t21-,22-,23+/m0/s1 |
| InChIKey | XZRXWECKGKKHQP-RJGXRXQPSA-N |
| XLogP | 3.43 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|